About 4-(2-hydroxyethyl)-4-prop-2-enoylhepta-1,6-diene-3,5-dione
4-(2-hydroxyethyl)-4-prop-2-enoylhepta-1,6-diene-3,5-dione (PubChem CID 139633583) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-4-prop-2-enoylhepta-1,6-diene-3,5-dione.
Molecular Properties
| Compound Name | 4-(2-hydroxyethyl)-4-prop-2-enoylhepta-1,6-diene-3,5-dione |
| PubChem CID | 139633583 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4-(2-hydroxyethyl)-4-prop-2-enoylhepta-1,6-diene-3,5-dione |
| SMILES | C=CC(=O)C(CCO)(C(=O)C=C)C(=O)C=C |
| InChI | InChI=1S/C12H14O4/c1-4-9(14)12(7-8-13,10(15)5-2)11(16)6-3/h4-6,13H,1-3,7-8H2 |
| InChIKey | ZQXMGNHYKMPMQH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-hydroxyethyl)-4-prop-2-enoylhepta-1,6-diene-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxyethyl)-4-prop-2-enoylhepta-1,6-diene-3,5-dione?
The IUPAC name of 4-(2-hydroxyethyl)-4-prop-2-enoylhepta-1,6-diene-3,5-dione (CID 139633583) is 4-(2-hydroxyethyl)-4-prop-2-enoylhepta-1,6-diene-3,5-dione.
What is the SMILES notation for 4-(2-hydroxyethyl)-4-prop-2-enoylhepta-1,6-diene-3,5-dione?
The canonical SMILES for 4-(2-hydroxyethyl)-4-prop-2-enoylhepta-1,6-diene-3,5-dione is C=CC(=O)C(CCO)(C(=O)C=C)C(=O)C=C.
What is the InChIKey of 4-(2-hydroxyethyl)-4-prop-2-enoylhepta-1,6-diene-3,5-dione?
The InChIKey is ZQXMGNHYKMPMQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-4-9(14)12(7-8-13,10(15)5-2)11(16)6-3/h4-6,13H,1-3,7-8H2.
What are the key properties of 4-(2-hydroxyethyl)-4-prop-2-enoylhepta-1,6-diene-3,5-dione?
4-(2-hydroxyethyl)-4-prop-2-enoylhepta-1,6-diene-3,5-dione has a molecular weight of 222.24 g/mol, XLogP of 0.62, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxyethyl)-4-prop-2-enoylhepta-1,6-diene-3,5-dione is sourced from PubChem (CID 139633583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).