About methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclohexylidene]acetate
methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclohexylidene]acetate (PubChem CID 139633710) has the molecular formula C22H44O5Si2
and a molecular weight of 444.76 g/mol. Its IUPAC name is methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclohexylidene]acetate.
Molecular Properties
| Compound Name | methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclohexylidene]acetate |
| PubChem CID | 139633710 |
| Molecular Formula | C22H44O5Si2 |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclohexylidene]acetate |
| SMILES | COC(=O)C=C1CC(O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)C1CO |
| InChI | InChI=1S/C22H44O5Si2/c1-21(2,3)28(8,9)26-17-12-16(13-20(24)25-7)18(15-23)19(14-17)27-29(10,11)22(4,5)6/h13,17-19,23H,12,14-15H2,1-11H3 |
| InChIKey | BTVYUJFTGBJIKQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclohexylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclohexylidene]acetate?
The IUPAC name of methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclohexylidene]acetate (CID 139633710) is methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclohexylidene]acetate.
What is the SMILES notation for methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclohexylidene]acetate?
The canonical SMILES for methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclohexylidene]acetate is COC(=O)C=C1CC(O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)C1CO.
What is the InChIKey of methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclohexylidene]acetate?
The InChIKey is BTVYUJFTGBJIKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O5Si2/c1-21(2,3)28(8,9)26-17-12-16(13-20(24)25-7)18(15-23)19(14-17)27-29(10,11)22(4,5)6/h13,17-19,23H,12,14-15H2,1-11H3.
What are the key properties of methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclohexylidene]acetate?
methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclohexylidene]acetate has a molecular weight of 444.76 g/mol, XLogP of 5.27, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclohexylidene]acetate is sourced from PubChem (CID 139633710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).