C18H40N2 — CID 139634498
1-N-dodecyl-1-N,2-N,2-N-trimethylpropane-1,2-diamine (PubChem CID 139634498) has the molecular formula C18H40N2 and a molecular weight of 284.53 g/mol. Its IUPAC name is 1-N-dodecyl-1-N,2-N,2-N-trimethylpropane-1,2-diamine.
| Compound Name | 1-N-dodecyl-1-N,2-N,2-N-trimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 139634498 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | 1-N-dodecyl-1-N,2-N,2-N-trimethylpropane-1,2-diamine |
| SMILES | CCCCCCCCCCCCN(C)CC(C)N(C)C |
| InChI | InChI=1S/C18H40N2/c1-6-7-8-9-10-11-12-13-14-15-16-20(5)17-18(2)19(3)4/h18H,6-17H2,1-5H3 |
| InChIKey | ARTPFIUWSGBOIG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|