C26H35N5O2 — CID 139634554
N-[[4-[2-(4-phenylpiperazin-1-yl)ethylcarbamoyl]cyclohexyl]methyl]pyridine-4-carboxamide (PubChem CID 139634554) has the molecular formula C26H35N5O2 and a molecular weight of 449.60 g/mol. Its IUPAC name is N-[[4-[2-(4-phenylpiperazin-1-yl)ethylcarbamoyl]cyclohexyl]methyl]pyridine-4-carboxamide.
| Compound Name | N-[[4-[2-(4-phenylpiperazin-1-yl)ethylcarbamoyl]cyclohexyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 139634554 |
| Molecular Formula | C26H35N5O2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | N-[[4-[2-(4-phenylpiperazin-1-yl)ethylcarbamoyl]cyclohexyl]methyl]pyridine-4-carboxamide |
| SMILES | O=C(NCC1CCC(C(=O)NCCN2CCN(c3ccccc3)CC2)CC1)c1ccncc1 |
| InChI | InChI=1S/C26H35N5O2/c32-25(28-14-15-30-16-18-31(19-17-30)24-4-2-1-3-5-24)22-8-6-21(7-9-22)20-29-26(33)23-10-12-27-13-11-23/h1-5,10-13,21-22H,6-9,14-20H2,(H,28,32)(H,29,33) |
| InChIKey | JKVDRZQGEVVTCG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |