C23H42O8 — CID 139634821
[(2R)-5-oxooxolan-2-yl]methyl 9,10,12,13-tetrahydroxyoctadecanoate (PubChem CID 139634821) has the molecular formula C23H42O8 and a molecular weight of 446.58 g/mol. Its IUPAC name is [(2R)-5-oxooxolan-2-yl]methyl 9,10,12,13-tetrahydroxyoctadecanoate.
| Compound Name | [(2R)-5-oxooxolan-2-yl]methyl 9,10,12,13-tetrahydroxyoctadecanoate |
|---|---|
| PubChem CID | 139634821 |
| Molecular Formula | C23H42O8 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | [(2R)-5-oxooxolan-2-yl]methyl 9,10,12,13-tetrahydroxyoctadecanoate |
| SMILES | CCCCCC(O)C(O)CC(O)C(O)CCCCCCCC(=O)OC[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C23H42O8/c1-2-3-7-10-18(24)20(26)15-21(27)19(25)11-8-5-4-6-9-12-22(28)30-16-17-13-14-23(29)31-17/h17-21,24-27H,2-16H2,1H3/t17-,18?,19?,20?,21?/m1/s1 |
| InChIKey | MXEKZTCSIYRGPP-QPCUUSJWSA-N |
| XLogP | 2.38 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|