C16H22O3S — CID 139636405
4-(2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)benzenesulfonic acid (PubChem CID 139636405) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is 4-(2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)benzenesulfonic acid.
| Compound Name | 4-(2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 139636405 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 4-(2,6,6-trimethyl-1-bicyclo[3.1.1]heptanyl)benzenesulfonic acid |
| SMILES | CC1CCC2CC1(c1ccc(S(=O)(=O)O)cc1)C2(C)C |
| InChI | InChI=1S/C16H22O3S/c1-11-4-5-13-10-16(11,15(13,2)3)12-6-8-14(9-7-12)20(17,18)19/h6-9,11,13H,4-5,10H2,1-3H3,(H,17,18,19) |
| InChIKey | LBKGLXLDWDDPAR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|