C12H15Cl2NO3 — CID 139636542
2,2-dichloro-1-[5-(furan-2-yl)-2,2,4-trimethyl-1,3-oxazolidin-3-yl]ethanone (PubChem CID 139636542) has the molecular formula C12H15Cl2NO3 and a molecular weight of 292.16 g/mol. Its IUPAC name is 2,2-dichloro-1-[5-(furan-2-yl)-2,2,4-trimethyl-1,3-oxazolidin-3-yl]ethanone.
| Compound Name | 2,2-dichloro-1-[5-(furan-2-yl)-2,2,4-trimethyl-1,3-oxazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 139636542 |
| Molecular Formula | C12H15Cl2NO3 |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2,2-dichloro-1-[5-(furan-2-yl)-2,2,4-trimethyl-1,3-oxazolidin-3-yl]ethanone |
| SMILES | CC1C(c2ccco2)OC(C)(C)N1C(=O)C(Cl)Cl |
| InChI | InChI=1S/C12H15Cl2NO3/c1-7-9(8-5-4-6-17-8)18-12(2,3)15(7)11(16)10(13)14/h4-7,9-10H,1-3H3 |
| InChIKey | QXEHUCYVWHHNFE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|