C17H16N2O5 — CID 139637047
7-(4,4-diamino-3-methylcyclohexa-1,5-dien-1-yl)oxy-2-oxochromene-3-carboxylic acid (PubChem CID 139637047) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is 7-(4,4-diamino-3-methylcyclohexa-1,5-dien-1-yl)oxy-2-oxochromene-3-carboxylic acid.
| Compound Name | 7-(4,4-diamino-3-methylcyclohexa-1,5-dien-1-yl)oxy-2-oxochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 139637047 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 7-(4,4-diamino-3-methylcyclohexa-1,5-dien-1-yl)oxy-2-oxochromene-3-carboxylic acid |
| SMILES | CC1C=C(Oc2ccc3cc(C(=O)O)c(=O)oc3c2)C=CC1(N)N |
| InChI | InChI=1S/C17H16N2O5/c1-9-6-12(4-5-17(9,18)19)23-11-3-2-10-7-13(15(20)21)16(22)24-14(10)8-11/h2-9H,18-19H2,1H3,(H,20,21) |
| InChIKey | BUORKWVLJXFJAF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|