About 3-ethylpent-1-en-3-yl propan-2-yl carbonate
3-ethylpent-1-en-3-yl propan-2-yl carbonate (PubChem CID 139638690) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-ethylpent-1-en-3-yl propan-2-yl carbonate.
Molecular Properties
| Compound Name | 3-ethylpent-1-en-3-yl propan-2-yl carbonate |
| PubChem CID | 139638690 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 3-ethylpent-1-en-3-yl propan-2-yl carbonate |
| SMILES | C=CC(CC)(CC)OC(=O)OC(C)C |
| InChI | InChI=1S/C11H20O3/c1-6-11(7-2,8-3)14-10(12)13-9(4)5/h6,9H,1,7-8H2,2-5H3 |
| InChIKey | KMLWUTVOEKQXPH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylpent-1-en-3-yl propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylpent-1-en-3-yl propan-2-yl carbonate?
The IUPAC name of 3-ethylpent-1-en-3-yl propan-2-yl carbonate (CID 139638690) is 3-ethylpent-1-en-3-yl propan-2-yl carbonate.
What is the SMILES notation for 3-ethylpent-1-en-3-yl propan-2-yl carbonate?
The canonical SMILES for 3-ethylpent-1-en-3-yl propan-2-yl carbonate is C=CC(CC)(CC)OC(=O)OC(C)C.
What is the InChIKey of 3-ethylpent-1-en-3-yl propan-2-yl carbonate?
The InChIKey is KMLWUTVOEKQXPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-6-11(7-2,8-3)14-10(12)13-9(4)5/h6,9H,1,7-8H2,2-5H3.
What are the key properties of 3-ethylpent-1-en-3-yl propan-2-yl carbonate?
3-ethylpent-1-en-3-yl propan-2-yl carbonate has a molecular weight of 200.28 g/mol, XLogP of 3.29, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylpent-1-en-3-yl propan-2-yl carbonate is sourced from PubChem (CID 139638690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).