C24H26N4O3 — CID 139640072
[6-[[1-(azidomethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]methyl]naphthalen-2-yl]methanol (PubChem CID 139640072) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is [6-[[1-(azidomethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]methyl]naphthalen-2-yl]methanol.
| Compound Name | [6-[[1-(azidomethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]methyl]naphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 139640072 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [6-[[1-(azidomethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]methyl]naphthalen-2-yl]methanol |
| SMILES | COc1cc2c(cc1OC)C(CN=[N+]=[N-])N(Cc1ccc3cc(CO)ccc3c1)CC2 |
| InChI | InChI=1S/C24H26N4O3/c1-30-23-11-20-7-8-28(22(13-26-27-25)21(20)12-24(23)31-2)14-16-3-5-19-10-17(15-29)4-6-18(19)9-16/h3-6,9-12,22,29H,7-8,13-15H2,1-2H3 |
| InChIKey | BMHQAYANMNZHBD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|