C15H6F16O4 — CID 139640378
bis(2,2,3,3,4,4,5,5-octafluorocyclopentyl) (Z)-2-methylbut-2-enedioate (PubChem CID 139640378) has the molecular formula C15H6F16O4 and a molecular weight of 554.18 g/mol. Its IUPAC name is bis(2,2,3,3,4,4,5,5-octafluorocyclopentyl) (Z)-2-methylbut-2-enedioate.
| Compound Name | bis(2,2,3,3,4,4,5,5-octafluorocyclopentyl) (Z)-2-methylbut-2-enedioate |
|---|---|
| PubChem CID | 139640378 |
| Molecular Formula | C15H6F16O4 |
| Molecular Weight | 554.18 g/mol |
| Exact Mass | 554.00 |
| IUPAC Name | bis(2,2,3,3,4,4,5,5-octafluorocyclopentyl) (Z)-2-methylbut-2-enedioate |
| SMILES | C/C(=C/C(=O)OC1C(F)(F)C(F)(F)C(F)(F)C1(F)F)C(=O)OC1C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C15H6F16O4/c1-3(5(33)35-7-10(20,21)14(28,29)15(30,31)11(7,22)23)2-4(32)34-6-8(16,17)12(24,25)13(26,27)9(6,18)19/h2,6-7H,1H3/b3-2- |
| InChIKey | ZLSAEASWOZDAJP-IHWYPQMZSA-N |
| XLogP | 4.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.18 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|