C17H6F20O4 — CID 139640388
bis(2,2,3,3,4,4,5,5,6,6-decafluorocyclohexyl) (E)-2-methylbut-2-enedioate (PubChem CID 139640388) has the molecular formula C17H6F20O4 and a molecular weight of 654.19 g/mol. Its IUPAC name is bis(2,2,3,3,4,4,5,5,6,6-decafluorocyclohexyl) (E)-2-methylbut-2-enedioate.
| Compound Name | bis(2,2,3,3,4,4,5,5,6,6-decafluorocyclohexyl) (E)-2-methylbut-2-enedioate |
|---|---|
| PubChem CID | 139640388 |
| Molecular Formula | C17H6F20O4 |
| Molecular Weight | 654.19 g/mol |
| Exact Mass | 653.99 |
| IUPAC Name | bis(2,2,3,3,4,4,5,5,6,6-decafluorocyclohexyl) (E)-2-methylbut-2-enedioate |
| SMILES | C/C(=C\C(=O)OC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F)C(=O)OC1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C17H6F20O4/c1-3(5(39)41-7-10(22,23)14(30,31)17(36,37)15(32,33)11(7,24)25)2-4(38)40-6-8(18,19)12(26,27)16(34,35)13(28,29)9(6,20)21/h2,6-7H,1H3/b3-2+ |
| InChIKey | XNWFRCKCTPEWQU-NSCUHMNNSA-N |
| XLogP | 6.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.19 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|