C13H12F10O4 — CID 139640390
bis(3,3,4,4,4-pentafluorobutan-2-yl) 2-methylidenebutanedioate (PubChem CID 139640390) has the molecular formula C13H12F10O4 and a molecular weight of 422.22 g/mol. Its IUPAC name is bis(3,3,4,4,4-pentafluorobutan-2-yl) 2-methylidenebutanedioate.
| Compound Name | bis(3,3,4,4,4-pentafluorobutan-2-yl) 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 139640390 |
| Molecular Formula | C13H12F10O4 |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | bis(3,3,4,4,4-pentafluorobutan-2-yl) 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC(C)C(F)(F)C(F)(F)F)C(=O)OC(C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H12F10O4/c1-5(9(25)27-7(3)11(16,17)13(21,22)23)4-8(24)26-6(2)10(14,15)12(18,19)20/h6-7H,1,4H2,2-3H3 |
| InChIKey | SVHCDZITTIRGDW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|