About 1,6-diiminoheptan-2-one
1,6-diiminoheptan-2-one (PubChem CID 139640588) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 1,6-diiminoheptan-2-one.
Molecular Properties
| Compound Name | 1,6-diiminoheptan-2-one |
| PubChem CID | 139640588 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 1,6-diiminoheptan-2-one |
| SMILES | [H]/N=C/C(=O)CCC/C(C)=N/[H] |
| InChI | InChI=1S/C7H12N2O/c1-6(9)3-2-4-7(10)5-8/h5,8-9H,2-4H2,1H3/b8-5+,9-6+ |
| InChIKey | OUMRXXJIWAZRIC-XVYDYJIPSA-N |
| XLogP | 1.42 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1,6-diiminoheptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-diiminoheptan-2-one?
The IUPAC name of 1,6-diiminoheptan-2-one (CID 139640588) is 1,6-diiminoheptan-2-one.
What is the SMILES notation for 1,6-diiminoheptan-2-one?
The canonical SMILES for 1,6-diiminoheptan-2-one is [H]/N=C/C(=O)CCC/C(C)=N/[H].
What is the InChIKey of 1,6-diiminoheptan-2-one?
The InChIKey is OUMRXXJIWAZRIC-XVYDYJIPSA-N. The full InChI is InChI=1S/C7H12N2O/c1-6(9)3-2-4-7(10)5-8/h5,8-9H,2-4H2,1H3/b8-5+,9-6+.
What are the key properties of 1,6-diiminoheptan-2-one?
1,6-diiminoheptan-2-one has a molecular weight of 140.19 g/mol, XLogP of 1.42, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-diiminoheptan-2-one is sourced from PubChem (CID 139640588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).