C19H28O2 — CID 139641241
cis-(2S,5S)-5-(4-ethoxyphenyl)-2-pentylcyclohexan-1-one (PubChem CID 139641241) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is cis-(2S,5S)-5-(4-ethoxyphenyl)-2-pentylcyclohexan-1-one.
| Compound Name | cis-(2S,5S)-5-(4-ethoxyphenyl)-2-pentylcyclohexan-1-one |
|---|---|
| PubChem CID | 139641241 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | cis-(2S,5S)-5-(4-ethoxyphenyl)-2-pentylcyclohexan-1-one |
| SMILES | CCCCC[C@H]1CC[C@H](c2ccc(OCC)cc2)CC1=O |
| InChI | InChI=1S/C19H28O2/c1-3-5-6-7-16-8-9-17(14-19(16)20)15-10-12-18(13-11-15)21-4-2/h10-13,16-17H,3-9,14H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | PAEOKTVMPCOSJK-IRXDYDNUSA-N |
| XLogP | 5.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|