About 3-chloro-4-sulfanylbenzene-1,2-dicarbonitrile
3-chloro-4-sulfanylbenzene-1,2-dicarbonitrile (PubChem CID 139641622) has the molecular formula C8H3ClN2S
and a molecular weight of 194.65 g/mol. Its IUPAC name is 3-chloro-4-sulfanylbenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 3-chloro-4-sulfanylbenzene-1,2-dicarbonitrile |
| PubChem CID | 139641622 |
| Molecular Formula | C8H3ClN2S |
| Molecular Weight | 194.65 g/mol |
| Exact Mass | 193.97 |
| IUPAC Name | 3-chloro-4-sulfanylbenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(S)c(Cl)c1C#N |
| InChI | InChI=1S/C8H3ClN2S/c9-8-6(4-11)5(3-10)1-2-7(8)12/h1-2,12H |
| InChIKey | GCKGGNJKAGKXFQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.65 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-sulfanylbenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-sulfanylbenzene-1,2-dicarbonitrile?
The IUPAC name of 3-chloro-4-sulfanylbenzene-1,2-dicarbonitrile (CID 139641622) is 3-chloro-4-sulfanylbenzene-1,2-dicarbonitrile.
What is the SMILES notation for 3-chloro-4-sulfanylbenzene-1,2-dicarbonitrile?
The canonical SMILES for 3-chloro-4-sulfanylbenzene-1,2-dicarbonitrile is N#Cc1ccc(S)c(Cl)c1C#N.
What is the InChIKey of 3-chloro-4-sulfanylbenzene-1,2-dicarbonitrile?
The InChIKey is GCKGGNJKAGKXFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3ClN2S/c9-8-6(4-11)5(3-10)1-2-7(8)12/h1-2,12H.
What are the key properties of 3-chloro-4-sulfanylbenzene-1,2-dicarbonitrile?
3-chloro-4-sulfanylbenzene-1,2-dicarbonitrile has a molecular weight of 194.65 g/mol, XLogP of 2.37, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-sulfanylbenzene-1,2-dicarbonitrile is sourced from PubChem (CID 139641622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).