C12H9N3 — CID 139642041
4,7,12-triazatricyclo[9.4.0.02,7]pentadeca-1,3,5,8,10,12,14-heptaene (PubChem CID 139642041) has the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 4,7,12-triazatricyclo[9.4.0.02,7]pentadeca-1,3,5,8,10,12,14-heptaene.
| Compound Name | 4,7,12-triazatricyclo[9.4.0.02,7]pentadeca-1,3,5,8,10,12,14-heptaene |
|---|---|
| PubChem CID | 139642041 |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 4,7,12-triazatricyclo[9.4.0.02,7]pentadeca-1,3,5,8,10,12,14-heptaene |
| SMILES | C1=CN2C=CN=CC2=c2cccnc2=C1 |
| InChI | InChI=1S/C12H9N3/c1-3-10-11(14-5-1)4-2-7-15-8-6-13-9-12(10)15/h1-9H |
| InChIKey | MBWVWTWMGYICFD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |