C22H30ClN5S — CID 139644093
N'-[14-[2-(diethylamino)ethyl]-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-10-yl]propane-1,3-diamine;hydrochloride (PubChem CID 139644093) has the molecular formula C22H30ClN5S and a molecular weight of 432.04 g/mol. Its IUPAC name is N'-[14-[2-(diethylamino)ethyl]-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-10-yl]propane-1,3-diamine;hydrochloride.
| Compound Name | N'-[14-[2-(diethylamino)ethyl]-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-10-yl]propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 139644093 |
| Molecular Formula | C22H30ClN5S |
| Molecular Weight | 432.04 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N'-[14-[2-(diethylamino)ethyl]-8-thia-14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9,11,13(16)-heptaen-10-yl]propane-1,3-diamine;hydrochloride |
| SMILES | CCN(CC)CCn1nc2c3c(c(NCCCN)ccc31)Sc1ccccc1-2.Cl |
| InChI | InChI=1S/C22H29N5S.ClH/c1-3-26(4-2)14-15-27-18-11-10-17(24-13-7-12-23)22-20(18)21(25-27)16-8-5-6-9-19(16)28-22;/h5-6,8-11,24H,3-4,7,12-15,23H2,1-2H3;1H |
| InChIKey | FCXSRKXTBUDTFA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.04 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|