C19H22N8S — CID 139646830
N,N-dimethyl-3-[4-[1-(2H-tetrazol-5-ylmethyl)pyrazolo[5,4-b]pyridin-3-yl]phenyl]sulfanylpropan-1-amine (PubChem CID 139646830) has the molecular formula C19H22N8S and a molecular weight of 394.51 g/mol. Its IUPAC name is N,N-dimethyl-3-[4-[1-(2H-tetrazol-5-ylmethyl)pyrazolo[5,4-b]pyridin-3-yl]phenyl]sulfanylpropan-1-amine.
| Compound Name | N,N-dimethyl-3-[4-[1-(2H-tetrazol-5-ylmethyl)pyrazolo[5,4-b]pyridin-3-yl]phenyl]sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 139646830 |
| Molecular Formula | C19H22N8S |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N,N-dimethyl-3-[4-[1-(2H-tetrazol-5-ylmethyl)pyrazolo[5,4-b]pyridin-3-yl]phenyl]sulfanylpropan-1-amine |
| SMILES | CN(C)CCCSc1ccc(-c2nn(Cc3nn[nH]n3)c3ncccc23)cc1 |
| InChI | InChI=1S/C19H22N8S/c1-26(2)11-4-12-28-15-8-6-14(7-9-15)18-16-5-3-10-20-19(16)27(23-18)13-17-21-24-25-22-17/h3,5-10H,4,11-13H2,1-2H3,(H,21,22,24,25) |
| InChIKey | YDTHECMFOZIJSA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|