C14H16Br2Cl2O4 — CID 139649065
2,5-bis(4-bromobutoxy)-3,6-dichlorocyclohexa-2,5-diene-1,4-dione (PubChem CID 139649065) has the molecular formula C14H16Br2Cl2O4 and a molecular weight of 478.99 g/mol. Its IUPAC name is 2,5-bis(4-bromobutoxy)-3,6-dichlorocyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis(4-bromobutoxy)-3,6-dichlorocyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 139649065 |
| Molecular Formula | C14H16Br2Cl2O4 |
| Molecular Weight | 478.99 g/mol |
| Exact Mass | 475.88 |
| IUPAC Name | 2,5-bis(4-bromobutoxy)-3,6-dichlorocyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C(Cl)=C(OCCCCBr)C(=O)C(Cl)=C1OCCCCBr |
| InChI | InChI=1S/C14H16Br2Cl2O4/c15-5-1-3-7-21-13-9(17)12(20)14(10(18)11(13)19)22-8-4-2-6-16/h1-8H2 |
| InChIKey | IAXHCOMIUVAQMH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.99 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|