C13H19Br2NO2 — CID 139649131
2,3-bis(4-bromobutoxy)pyridine (PubChem CID 139649131) has the molecular formula C13H19Br2NO2 and a molecular weight of 381.11 g/mol. Its IUPAC name is 2,3-bis(4-bromobutoxy)pyridine.
| Compound Name | 2,3-bis(4-bromobutoxy)pyridine |
|---|---|
| PubChem CID | 139649131 |
| Molecular Formula | C13H19Br2NO2 |
| Molecular Weight | 381.11 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | 2,3-bis(4-bromobutoxy)pyridine |
| SMILES | BrCCCCOc1cccnc1OCCCCBr |
| InChI | InChI=1S/C13H19Br2NO2/c14-7-1-3-10-17-12-6-5-9-16-13(12)18-11-4-2-8-15/h5-6,9H,1-4,7-8,10-11H2 |
| InChIKey | WWYKGSJPGQARQP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.11 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|