C11H17BrO5S — CID 139649140
1-(4-bromobutoxy)-6-methoxycyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 139649140) has the molecular formula C11H17BrO5S and a molecular weight of 341.22 g/mol. Its IUPAC name is 1-(4-bromobutoxy)-6-methoxycyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 1-(4-bromobutoxy)-6-methoxycyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 139649140 |
| Molecular Formula | C11H17BrO5S |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 1-(4-bromobutoxy)-6-methoxycyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | COC1C=CC=CC1(OCCCCBr)S(=O)(=O)O |
| InChI | InChI=1S/C11H17BrO5S/c1-16-10-6-2-3-7-11(10,18(13,14)15)17-9-5-4-8-12/h2-3,6-7,10H,4-5,8-9H2,1H3,(H,13,14,15) |
| InChIKey | XTNIASRHLLHCJW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|