C11H24N2 — CID 139650373
N,2,2,3-tetramethyl-N-propylbutanimidamide (PubChem CID 139650373) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is N,2,2,3-tetramethyl-N-propylbutanimidamide.
| Compound Name | N,2,2,3-tetramethyl-N-propylbutanimidamide |
|---|---|
| PubChem CID | 139650373 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | N,2,2,3-tetramethyl-N-propylbutanimidamide |
| SMILES | [H]/N=C(\N(C)CCC)C(C)(C)C(C)C |
| InChI | InChI=1S/C11H24N2/c1-7-8-13(6)10(12)11(4,5)9(2)3/h9,12H,7-8H2,1-6H3/b12-10- |
| InChIKey | ZIEZDVMTQOGJTH-BENRWUELSA-N |
| XLogP | 2.99 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|