About 2-(butylamino)-N-[4-(4-nitrophenyl)sulfanylphenyl]acetamide;hydrochloride
2-(butylamino)-N-[4-(4-nitrophenyl)sulfanylphenyl]acetamide;hydrochloride (PubChem CID 139650784) has the molecular formula C18H22ClN3O3S
and a molecular weight of 395.91 g/mol. Its IUPAC name is 2-(butylamino)-N-[4-(4-nitrophenyl)sulfanylphenyl]acetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-(butylamino)-N-[4-(4-nitrophenyl)sulfanylphenyl]acetamide;hydrochloride |
| PubChem CID | 139650784 |
| Molecular Formula | C18H22ClN3O3S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-(butylamino)-N-[4-(4-nitrophenyl)sulfanylphenyl]acetamide;hydrochloride |
| SMILES | CCCCNCC(=O)Nc1ccc(Sc2ccc([N+](=O)[O-])cc2)cc1.Cl |
| InChI | InChI=1S/C18H21N3O3S.ClH/c1-2-3-12-19-13-18(22)20-14-4-8-16(9-5-14)25-17-10-6-15(7-11-17)21(23)24;/h4-11,19H,2-3,12-13H2,1H3,(H,20,22);1H |
| InChIKey | FUWKXZKBPBQWBV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(butylamino)-N-[4-(4-nitrophenyl)sulfanylphenyl]acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butylamino)-N-[4-(4-nitrophenyl)sulfanylphenyl]acetamide;hydrochloride?
The IUPAC name of 2-(butylamino)-N-[4-(4-nitrophenyl)sulfanylphenyl]acetamide;hydrochloride (CID 139650784) is 2-(butylamino)-N-[4-(4-nitrophenyl)sulfanylphenyl]acetamide;hydrochloride.
What is the SMILES notation for 2-(butylamino)-N-[4-(4-nitrophenyl)sulfanylphenyl]acetamide;hydrochloride?
The canonical SMILES for 2-(butylamino)-N-[4-(4-nitrophenyl)sulfanylphenyl]acetamide;hydrochloride is CCCCNCC(=O)Nc1ccc(Sc2ccc([N+](=O)[O-])cc2)cc1.Cl.
What is the InChIKey of 2-(butylamino)-N-[4-(4-nitrophenyl)sulfanylphenyl]acetamide;hydrochloride?
The InChIKey is FUWKXZKBPBQWBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O3S.ClH/c1-2-3-12-19-13-18(22)20-14-4-8-16(9-5-14)25-17-10-6-15(7-11-17)21(23)24;/h4-11,19H,2-3,12-13H2,1H3,(H,20,22);1H.
What are the key properties of 2-(butylamino)-N-[4-(4-nitrophenyl)sulfanylphenyl]acetamide;hydrochloride?
2-(butylamino)-N-[4-(4-nitrophenyl)sulfanylphenyl]acetamide;hydrochloride has a molecular weight of 395.91 g/mol, XLogP of 4.50, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butylamino)-N-[4-(4-nitrophenyl)sulfanylphenyl]acetamide;hydrochloride is sourced from PubChem (CID 139650784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).