C16H21NO2S2 — CID 139651105
3-[(2,5-dimethoxy-3,4,6-trimethylphenyl)methyl]-4-methyl-1,3-thiazole-2-thione (PubChem CID 139651105) has the molecular formula C16H21NO2S2 and a molecular weight of 323.48 g/mol. Its IUPAC name is 3-[(2,5-dimethoxy-3,4,6-trimethylphenyl)methyl]-4-methyl-1,3-thiazole-2-thione.
| Compound Name | 3-[(2,5-dimethoxy-3,4,6-trimethylphenyl)methyl]-4-methyl-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 139651105 |
| Molecular Formula | C16H21NO2S2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 3-[(2,5-dimethoxy-3,4,6-trimethylphenyl)methyl]-4-methyl-1,3-thiazole-2-thione |
| SMILES | COc1c(C)c(C)c(OC)c(Cn2c(C)csc2=S)c1C |
| InChI | InChI=1S/C16H21NO2S2/c1-9-8-21-16(20)17(9)7-13-12(4)14(18-5)10(2)11(3)15(13)19-6/h8H,7H2,1-6H3 |
| InChIKey | KNEGIVATJWMWRG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|