About 2-(methoxymethyl)-N,N,4-trimethyl-2-propan-2-ylpentan-1-amine
2-(methoxymethyl)-N,N,4-trimethyl-2-propan-2-ylpentan-1-amine (PubChem CID 139652139) has the molecular formula C13H29NO
and a molecular weight of 215.38 g/mol. Its IUPAC name is 2-(methoxymethyl)-N,N,4-trimethyl-2-propan-2-ylpentan-1-amine.
Molecular Properties
| Compound Name | 2-(methoxymethyl)-N,N,4-trimethyl-2-propan-2-ylpentan-1-amine |
| PubChem CID | 139652139 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | 2-(methoxymethyl)-N,N,4-trimethyl-2-propan-2-ylpentan-1-amine |
| SMILES | COCC(CC(C)C)(CN(C)C)C(C)C |
| InChI | InChI=1S/C13H29NO/c1-11(2)8-13(10-15-7,12(3)4)9-14(5)6/h11-12H,8-10H2,1-7H3 |
| InChIKey | NKLLQGJXQDRIDL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(methoxymethyl)-N,N,4-trimethyl-2-propan-2-ylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)-N,N,4-trimethyl-2-propan-2-ylpentan-1-amine?
The IUPAC name of 2-(methoxymethyl)-N,N,4-trimethyl-2-propan-2-ylpentan-1-amine (CID 139652139) is 2-(methoxymethyl)-N,N,4-trimethyl-2-propan-2-ylpentan-1-amine.
What is the SMILES notation for 2-(methoxymethyl)-N,N,4-trimethyl-2-propan-2-ylpentan-1-amine?
The canonical SMILES for 2-(methoxymethyl)-N,N,4-trimethyl-2-propan-2-ylpentan-1-amine is COCC(CC(C)C)(CN(C)C)C(C)C.
What is the InChIKey of 2-(methoxymethyl)-N,N,4-trimethyl-2-propan-2-ylpentan-1-amine?
The InChIKey is NKLLQGJXQDRIDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29NO/c1-11(2)8-13(10-15-7,12(3)4)9-14(5)6/h11-12H,8-10H2,1-7H3.
What are the key properties of 2-(methoxymethyl)-N,N,4-trimethyl-2-propan-2-ylpentan-1-amine?
2-(methoxymethyl)-N,N,4-trimethyl-2-propan-2-ylpentan-1-amine has a molecular weight of 215.38 g/mol, XLogP of 2.88, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)-N,N,4-trimethyl-2-propan-2-ylpentan-1-amine is sourced from PubChem (CID 139652139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).