C26H39F3 — CID 139652247
1,2,4,5-tetradeuterio-3-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]-6-(trifluoromethyl)benzene (PubChem CID 139652247) has the molecular formula C26H39F3 and a molecular weight of 412.62 g/mol. Its IUPAC name is 1,2,4,5-tetradeuterio-3-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]-6-(trifluoromethyl)benzene.
| Compound Name | 1,2,4,5-tetradeuterio-3-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]-6-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 139652247 |
| Molecular Formula | C26H39F3 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | 1,2,4,5-tetradeuterio-3-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]-6-(trifluoromethyl)benzene |
| SMILES | [2H]c1c([2H])c(C(F)(F)F)c([2H])c([2H])c1CCC1CCC(C2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C26H39F3/c1-2-3-4-5-20-8-14-23(15-9-20)24-16-10-21(11-17-24)6-7-22-12-18-25(19-13-22)26(27,28)29/h12-13,18-21,23-24H,2-11,14-17H2,1H3/i12D,13D,18D,19D |
| InChIKey | BXWCVRLTHJYHGQ-HNQHHGMMSA-N |
| XLogP | 8.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|