About 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylethanone;butyl(triphenyl)boranuide
1-(4-bromophenyl)-2-pyridin-1-ium-1-ylethanone;butyl(triphenyl)boranuide (PubChem CID 139652573) has the molecular formula C35H35BBrNO
and a molecular weight of 576.39 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylethanone;butyl(triphenyl)boranuide.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylethanone;butyl(triphenyl)boranuide |
| PubChem CID | 139652573 |
| Molecular Formula | C35H35BBrNO |
| Molecular Weight | 576.39 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylethanone;butyl(triphenyl)boranuide |
| SMILES | CCCC[B-](c1ccccc1)(c1ccccc1)c1ccccc1.O=C(C[n+]1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H24B.C13H11BrNO/c1-2-3-19-23(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;14-12-6-4-11(5-7-12)13(16)10-15-8-2-1-3-9-15/h4-18H,2-3,19H2,1H3;1-9H,10H2/q-1;+1 |
| InChIKey | DYFBIEQFUFYWBC-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 576.39 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylethanone;butyl(triphenyl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylethanone;butyl(triphenyl)boranuide?
The IUPAC name of 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylethanone;butyl(triphenyl)boranuide (CID 139652573) is 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylethanone;butyl(triphenyl)boranuide.
What is the SMILES notation for 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylethanone;butyl(triphenyl)boranuide?
The canonical SMILES for 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylethanone;butyl(triphenyl)boranuide is CCCC[B-](c1ccccc1)(c1ccccc1)c1ccccc1.O=C(C[n+]1ccccc1)c1ccc(Br)cc1.
What is the InChIKey of 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylethanone;butyl(triphenyl)boranuide?
The InChIKey is DYFBIEQFUFYWBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24B.C13H11BrNO/c1-2-3-19-23(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;14-12-6-4-11(5-7-12)13(16)10-15-8-2-1-3-9-15/h4-18H,2-3,19H2,1H3;1-9H,10H2/q-1;+1.
What are the key properties of 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylethanone;butyl(triphenyl)boranuide?
1-(4-bromophenyl)-2-pyridin-1-ium-1-ylethanone;butyl(triphenyl)boranuide has a molecular weight of 576.39 g/mol, XLogP of 6.58, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-2-pyridin-1-ium-1-ylethanone;butyl(triphenyl)boranuide is sourced from PubChem (CID 139652573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).