C52H76N2O4P2 — CID 139652880
[4-bis(2-tert-butyl-4,6-dimethylphenoxy)phosphanylpiperazin-1-yl]-bis(2-tert-butyl-4,6-dimethylphenoxy)phosphane (PubChem CID 139652880) has the molecular formula C52H76N2O4P2 and a molecular weight of 855.14 g/mol. Its IUPAC name is [4-bis(2-tert-butyl-4,6-dimethylphenoxy)phosphanylpiperazin-1-yl]-bis(2-tert-butyl-4,6-dimethylphenoxy)phosphane.
| Compound Name | [4-bis(2-tert-butyl-4,6-dimethylphenoxy)phosphanylpiperazin-1-yl]-bis(2-tert-butyl-4,6-dimethylphenoxy)phosphane |
|---|---|
| PubChem CID | 139652880 |
| Molecular Formula | C52H76N2O4P2 |
| Molecular Weight | 855.14 g/mol |
| Exact Mass | 854.53 |
| IUPAC Name | [4-bis(2-tert-butyl-4,6-dimethylphenoxy)phosphanylpiperazin-1-yl]-bis(2-tert-butyl-4,6-dimethylphenoxy)phosphane |
| SMILES | Cc1cc(C)c(OP(Oc2c(C)cc(C)cc2C(C)(C)C)N2CCN(P(Oc3c(C)cc(C)cc3C(C)(C)C)Oc3c(C)cc(C)cc3C(C)(C)C)CC2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C52H76N2O4P2/c1-33-25-37(5)45(41(29-33)49(9,10)11)55-59(56-46-38(6)26-34(2)30-42(46)50(12,13)14)53-21-23-54(24-22-53)60(57-47-39(7)27-35(3)31-43(47)51(15,16)17)58-48-40(8)28-36(4)32-44(48)52(18,19)20/h25-32H,21-24H2,1-20H3 |
| InChIKey | NRPKJLSDPPNCKG-UHFFFAOYSA-N |
| XLogP | 15.03 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.14 |
| LogP ≤ 5 | 15.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|