C25H18ClFO4S2 — CID 139652969
1-[[4-(4-chlorophenyl)sulfonylphenyl]methyl]-4-(4-fluorophenyl)sulfonylbenzene (PubChem CID 139652969) has the molecular formula C25H18ClFO4S2 and a molecular weight of 501.00 g/mol. Its IUPAC name is 1-[[4-(4-chlorophenyl)sulfonylphenyl]methyl]-4-(4-fluorophenyl)sulfonylbenzene.
| Compound Name | 1-[[4-(4-chlorophenyl)sulfonylphenyl]methyl]-4-(4-fluorophenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 139652969 |
| Molecular Formula | C25H18ClFO4S2 |
| Molecular Weight | 501.00 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | 1-[[4-(4-chlorophenyl)sulfonylphenyl]methyl]-4-(4-fluorophenyl)sulfonylbenzene |
| SMILES | O=S(=O)(c1ccc(F)cc1)c1ccc(Cc2ccc(S(=O)(=O)c3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H18ClFO4S2/c26-20-5-13-24(14-6-20)32(28,29)22-9-1-18(2-10-22)17-19-3-11-23(12-4-19)33(30,31)25-15-7-21(27)8-16-25/h1-16H,17H2 |
| InChIKey | JXUBRDPAAFRTMF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.00 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |