About 5-ethenoxy-N,N-dipentylpentan-1-amine
5-ethenoxy-N,N-dipentylpentan-1-amine (PubChem CID 139652992) has the molecular formula C17H35NO
and a molecular weight of 269.47 g/mol. Its IUPAC name is 5-ethenoxy-N,N-dipentylpentan-1-amine.
Molecular Properties
| Compound Name | 5-ethenoxy-N,N-dipentylpentan-1-amine |
| PubChem CID | 139652992 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | 5-ethenoxy-N,N-dipentylpentan-1-amine |
| SMILES | C=COCCCCCN(CCCCC)CCCCC |
| InChI | InChI=1S/C17H35NO/c1-4-7-10-14-18(15-11-8-5-2)16-12-9-13-17-19-6-3/h6H,3-5,7-17H2,1-2H3 |
| InChIKey | KAKDRFUKBDHHQN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenoxy-N,N-dipentylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenoxy-N,N-dipentylpentan-1-amine?
The IUPAC name of 5-ethenoxy-N,N-dipentylpentan-1-amine (CID 139652992) is 5-ethenoxy-N,N-dipentylpentan-1-amine.
What is the SMILES notation for 5-ethenoxy-N,N-dipentylpentan-1-amine?
The canonical SMILES for 5-ethenoxy-N,N-dipentylpentan-1-amine is C=COCCCCCN(CCCCC)CCCCC.
What is the InChIKey of 5-ethenoxy-N,N-dipentylpentan-1-amine?
The InChIKey is KAKDRFUKBDHHQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO/c1-4-7-10-14-18(15-11-8-5-2)16-12-9-13-17-19-6-3/h6H,3-5,7-17H2,1-2H3.
What are the key properties of 5-ethenoxy-N,N-dipentylpentan-1-amine?
5-ethenoxy-N,N-dipentylpentan-1-amine has a molecular weight of 269.47 g/mol, XLogP of 5.00, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenoxy-N,N-dipentylpentan-1-amine is sourced from PubChem (CID 139652992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).