C17H19N3O2 — CID 139653553
2-methoxyimino-N'-methyl-2-[2-(phenoxymethyl)phenyl]ethanimidamide (PubChem CID 139653553) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-methoxyimino-N'-methyl-2-[2-(phenoxymethyl)phenyl]ethanimidamide.
| Compound Name | 2-methoxyimino-N'-methyl-2-[2-(phenoxymethyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 139653553 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-methoxyimino-N'-methyl-2-[2-(phenoxymethyl)phenyl]ethanimidamide |
| SMILES | C/N=C(\N)C(=NOC)c1ccccc1COc1ccccc1 |
| InChI | InChI=1S/C17H19N3O2/c1-19-17(18)16(20-21-2)15-11-7-6-8-13(15)12-22-14-9-4-3-5-10-14/h3-11H,12H2,1-2H3,(H2,18,19) |
| InChIKey | GWCINIHZNHUFME-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|