C23H29F2NO2 — CID 139654581
2,6-difluoro-N-[3-(3-heptylphenyl)-3-hydroxypropyl]benzamide (PubChem CID 139654581) has the molecular formula C23H29F2NO2 and a molecular weight of 389.49 g/mol. Its IUPAC name is 2,6-difluoro-N-[3-(3-heptylphenyl)-3-hydroxypropyl]benzamide.
| Compound Name | 2,6-difluoro-N-[3-(3-heptylphenyl)-3-hydroxypropyl]benzamide |
|---|---|
| PubChem CID | 139654581 |
| Molecular Formula | C23H29F2NO2 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 2,6-difluoro-N-[3-(3-heptylphenyl)-3-hydroxypropyl]benzamide |
| SMILES | CCCCCCCc1cccc(C(O)CCNC(=O)c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C23H29F2NO2/c1-2-3-4-5-6-9-17-10-7-11-18(16-17)21(27)14-15-26-23(28)22-19(24)12-8-13-20(22)25/h7-8,10-13,16,21,27H,2-6,9,14-15H2,1H3,(H,26,28) |
| InChIKey | XWBFGWJZSXOFFL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|