C12H13ClN4OS — CID 139654914
5-(5,6-dimethyl-1H-benzimidazol-2-yl)-3,6-dihydro-1,3,4-thiadiazin-2-one;hydrochloride (PubChem CID 139654914) has the molecular formula C12H13ClN4OS and a molecular weight of 296.78 g/mol. Its IUPAC name is 5-(5,6-dimethyl-1H-benzimidazol-2-yl)-3,6-dihydro-1,3,4-thiadiazin-2-one;hydrochloride.
| Compound Name | 5-(5,6-dimethyl-1H-benzimidazol-2-yl)-3,6-dihydro-1,3,4-thiadiazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 139654914 |
| Molecular Formula | C12H13ClN4OS |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 5-(5,6-dimethyl-1H-benzimidazol-2-yl)-3,6-dihydro-1,3,4-thiadiazin-2-one;hydrochloride |
| SMILES | Cc1cc2nc(C3=NNC(=O)SC3)[nH]c2cc1C.Cl |
| InChI | InChI=1S/C12H12N4OS.ClH/c1-6-3-8-9(4-7(6)2)14-11(13-8)10-5-18-12(17)16-15-10;/h3-4H,5H2,1-2H3,(H,13,14)(H,16,17);1H |
| InChIKey | HMNTYDHGCWFJMR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|