About 2-(3-cyano-1,3-dihydropyrrol-2-ylidene)propanedinitrile
2-(3-cyano-1,3-dihydropyrrol-2-ylidene)propanedinitrile (PubChem CID 139655139) has the molecular formula C8H4N4
and a molecular weight of 156.15 g/mol. Its IUPAC name is 2-(3-cyano-1,3-dihydropyrrol-2-ylidene)propanedinitrile.
Molecular Properties
| Compound Name | 2-(3-cyano-1,3-dihydropyrrol-2-ylidene)propanedinitrile |
| PubChem CID | 139655139 |
| Molecular Formula | C8H4N4 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 2-(3-cyano-1,3-dihydropyrrol-2-ylidene)propanedinitrile |
| SMILES | N#CC(C#N)=C1NC=CC1C#N |
| InChI | InChI=1S/C8H4N4/c9-3-6-1-2-12-8(6)7(4-10)5-11/h1-2,6,12H |
| InChIKey | FTIMCCIBSMWLCR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-cyano-1,3-dihydropyrrol-2-ylidene)propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-cyano-1,3-dihydropyrrol-2-ylidene)propanedinitrile?
The IUPAC name of 2-(3-cyano-1,3-dihydropyrrol-2-ylidene)propanedinitrile (CID 139655139) is 2-(3-cyano-1,3-dihydropyrrol-2-ylidene)propanedinitrile.
What is the SMILES notation for 2-(3-cyano-1,3-dihydropyrrol-2-ylidene)propanedinitrile?
The canonical SMILES for 2-(3-cyano-1,3-dihydropyrrol-2-ylidene)propanedinitrile is N#CC(C#N)=C1NC=CC1C#N.
What is the InChIKey of 2-(3-cyano-1,3-dihydropyrrol-2-ylidene)propanedinitrile?
The InChIKey is FTIMCCIBSMWLCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N4/c9-3-6-1-2-12-8(6)7(4-10)5-11/h1-2,6,12H.
What are the key properties of 2-(3-cyano-1,3-dihydropyrrol-2-ylidene)propanedinitrile?
2-(3-cyano-1,3-dihydropyrrol-2-ylidene)propanedinitrile has a molecular weight of 156.15 g/mol, XLogP of 0.54, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyano-1,3-dihydropyrrol-2-ylidene)propanedinitrile is sourced from PubChem (CID 139655139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).