C8H13N3O — CID 139655197
5-imino-4-methylidene-1-(2-methylpropyl)imidazolidin-2-one (PubChem CID 139655197) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 5-imino-4-methylidene-1-(2-methylpropyl)imidazolidin-2-one.
| Compound Name | 5-imino-4-methylidene-1-(2-methylpropyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 139655197 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 5-imino-4-methylidene-1-(2-methylpropyl)imidazolidin-2-one |
| SMILES | [H]/N=C1\C(=C)NC(=O)N1CC(C)C |
| InChI | InChI=1S/C8H13N3O/c1-5(2)4-11-7(9)6(3)10-8(11)12/h5,9H,3-4H2,1-2H3,(H,10,12)/b9-7+ |
| InChIKey | HLSVXKVQJYMKFQ-VQHVLOKHSA-N |
| XLogP | 1.16 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|