C18H15ClF3N3O3S — CID 1396578
4-[2-chloro-5-(trifluoromethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 1396578) has the molecular formula C18H15ClF3N3O3S and a molecular weight of 445.85 g/mol. Its IUPAC name is 4-[2-chloro-5-(trifluoromethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[2-chloro-5-(trifluoromethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 1396578 |
| Molecular Formula | C18H15ClF3N3O3S |
| Molecular Weight | 445.85 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 4-[2-chloro-5-(trifluoromethyl)phenyl]-3-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc(-c2n[nH]c(=S)n2-c2cc(C(F)(F)F)ccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C18H15ClF3N3O3S/c1-26-13-6-9(7-14(27-2)15(13)28-3)16-23-24-17(29)25(16)12-8-10(18(20,21)22)4-5-11(12)19/h4-8H,1-3H3,(H,24,29) |
| InChIKey | VYFNERBLMCKEOZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.85 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|