C17H6Br8O5 — CID 139658565
2,3,4,5-tetrabromo-6-[2-oxo-3-(2,3,4,5-tetrabromo-6-carboxyphenyl)propyl]benzoic acid (PubChem CID 139658565) has the molecular formula C17H6Br8O5 and a molecular weight of 929.46 g/mol. Its IUPAC name is 2,3,4,5-tetrabromo-6-[2-oxo-3-(2,3,4,5-tetrabromo-6-carboxyphenyl)propyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrabromo-6-[2-oxo-3-(2,3,4,5-tetrabromo-6-carboxyphenyl)propyl]benzoic acid |
|---|---|
| PubChem CID | 139658565 |
| Molecular Formula | C17H6Br8O5 |
| Molecular Weight | 929.46 g/mol |
| Exact Mass | 921.37 |
| IUPAC Name | 2,3,4,5-tetrabromo-6-[2-oxo-3-(2,3,4,5-tetrabromo-6-carboxyphenyl)propyl]benzoic acid |
| SMILES | O=C(Cc1c(Br)c(Br)c(Br)c(Br)c1C(=O)O)Cc1c(Br)c(Br)c(Br)c(Br)c1C(=O)O |
| InChI | InChI=1S/C17H6Br8O5/c18-8-4(6(16(27)28)10(20)14(24)12(8)22)1-3(26)2-5-7(17(29)30)11(21)15(25)13(23)9(5)19/h1-2H2,(H,27,28)(H,29,30) |
| InChIKey | YUMWFIDYVIUECZ-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.46 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|