C20H21N3O6 — CID 139658748
5-O-(2-cyanoethyl) 3-O-ethyl 2,6-dimethyl-1-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 139658748) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is 5-O-(2-cyanoethyl) 3-O-ethyl 2,6-dimethyl-1-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | 5-O-(2-cyanoethyl) 3-O-ethyl 2,6-dimethyl-1-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 139658748 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 5-O-(2-cyanoethyl) 3-O-ethyl 2,6-dimethyl-1-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2cccc([N+](=O)[O-])c2)C(C)=C(C(=O)OCCC#N)C1 |
| InChI | InChI=1S/C20H21N3O6/c1-4-28-19(24)17-12-18(20(25)29-10-6-9-21)14(3)22(13(17)2)15-7-5-8-16(11-15)23(26)27/h5,7-8,11H,4,6,10,12H2,1-3H3 |
| InChIKey | PFEFZORSIGUBCW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 122.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|