About 1,2-diethynyl-3,5-dimethylbenzene
1,2-diethynyl-3,5-dimethylbenzene (PubChem CID 139658903) has the molecular formula C12H10
and a molecular weight of 154.21 g/mol. Its IUPAC name is 1,2-diethynyl-3,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1,2-diethynyl-3,5-dimethylbenzene |
| PubChem CID | 139658903 |
| Molecular Formula | C12H10 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 1,2-diethynyl-3,5-dimethylbenzene |
| SMILES | C#Cc1cc(C)cc(C)c1C#C |
| InChI | InChI=1S/C12H10/c1-5-11-8-9(3)7-10(4)12(11)6-2/h1-2,7-8H,3-4H3 |
| InChIKey | FDZKIGZMVHQEDH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diethynyl-3,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethynyl-3,5-dimethylbenzene?
The IUPAC name of 1,2-diethynyl-3,5-dimethylbenzene (CID 139658903) is 1,2-diethynyl-3,5-dimethylbenzene.
What is the SMILES notation for 1,2-diethynyl-3,5-dimethylbenzene?
The canonical SMILES for 1,2-diethynyl-3,5-dimethylbenzene is C#Cc1cc(C)cc(C)c1C#C.
What is the InChIKey of 1,2-diethynyl-3,5-dimethylbenzene?
The InChIKey is FDZKIGZMVHQEDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10/c1-5-11-8-9(3)7-10(4)12(11)6-2/h1-2,7-8H,3-4H3.
What are the key properties of 1,2-diethynyl-3,5-dimethylbenzene?
1,2-diethynyl-3,5-dimethylbenzene has a molecular weight of 154.21 g/mol, XLogP of 2.27, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethynyl-3,5-dimethylbenzene is sourced from PubChem (CID 139658903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).