C11H12O2 — CID 139659158
5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde (PubChem CID 139659158) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is 5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde.
| Compound Name | 5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde |
|---|---|
| PubChem CID | 139659158 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde |
| SMILES | Cc1c(C=O)ccc2c1CCCO2 |
| InChI | InChI=1S/C11H12O2/c1-8-9(7-12)4-5-11-10(8)3-2-6-13-11/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | RIFSPWNAHAYGAE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|