About 5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde
5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde (PubChem CID 139659158) has the molecular formula C11H12O2
and a molecular weight of 176.22 g/mol. Its IUPAC name is 5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde.
Molecular Properties
| Compound Name | 5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde |
| PubChem CID | 139659158 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde |
| SMILES | Cc1c(C=O)ccc2c1CCCO2 |
| InChI | InChI=1S/C11H12O2/c1-8-9(7-12)4-5-11-10(8)3-2-6-13-11/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | RIFSPWNAHAYGAE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde?
The IUPAC name of 5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde (CID 139659158) is 5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde.
What is the SMILES notation for 5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde?
The canonical SMILES for 5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde is Cc1c(C=O)ccc2c1CCCO2.
What is the InChIKey of 5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde?
The InChIKey is RIFSPWNAHAYGAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c1-8-9(7-12)4-5-11-10(8)3-2-6-13-11/h4-5,7H,2-3,6H2,1H3.
What are the key properties of 5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde?
5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde has a molecular weight of 176.22 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3,4-dihydro-2H-chromene-6-carbaldehyde is sourced from PubChem (CID 139659158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).