C27H26N2O4S3 — CID 139660213
[4-[[4-(4-methylsulfanylphenyl)-5-phenyl-1,3-thiazol-2-yl]sulfamoyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 139660213) has the molecular formula C27H26N2O4S3 and a molecular weight of 538.72 g/mol. Its IUPAC name is [4-[[4-(4-methylsulfanylphenyl)-5-phenyl-1,3-thiazol-2-yl]sulfamoyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[[4-(4-methylsulfanylphenyl)-5-phenyl-1,3-thiazol-2-yl]sulfamoyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 139660213 |
| Molecular Formula | C27H26N2O4S3 |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | [4-[[4-(4-methylsulfanylphenyl)-5-phenyl-1,3-thiazol-2-yl]sulfamoyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CSc1ccc(-c2nc(NS(=O)(=O)c3ccc(OC(=O)C(C)(C)C)cc3)sc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H26N2O4S3/c1-27(2,3)25(30)33-20-12-16-22(17-13-20)36(31,32)29-26-28-23(18-10-14-21(34-4)15-11-18)24(35-26)19-8-6-5-7-9-19/h5-17H,1-4H3,(H,28,29) |
| InChIKey | NTVKBHRKOQRJIK-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|