About prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyanoethyl)pyrrolidine-1-carboxylate
prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyanoethyl)pyrrolidine-1-carboxylate (PubChem CID 139660628) has the molecular formula C17H30N2O3Si
and a molecular weight of 338.52 g/mol. Its IUPAC name is prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyanoethyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyanoethyl)pyrrolidine-1-carboxylate |
| PubChem CID | 139660628 |
| Molecular Formula | C17H30N2O3Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyanoethyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1CCC#N |
| InChI | InChI=1S/C17H30N2O3Si/c1-7-11-21-16(20)19-13-15(12-14(19)9-8-10-18)22-23(5,6)17(2,3)4/h7,14-15H,1,8-9,11-13H2,2-6H3/t14-,15-/m1/s1 |
| InChIKey | KQYGEBZRHIVPGV-HUUCEWRRSA-N |
| XLogP | 4.08 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyanoethyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyanoethyl)pyrrolidine-1-carboxylate?
The IUPAC name of prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyanoethyl)pyrrolidine-1-carboxylate (CID 139660628) is prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyanoethyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyanoethyl)pyrrolidine-1-carboxylate?
The canonical SMILES for prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyanoethyl)pyrrolidine-1-carboxylate is C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1CCC#N.
What is the InChIKey of prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyanoethyl)pyrrolidine-1-carboxylate?
The InChIKey is KQYGEBZRHIVPGV-HUUCEWRRSA-N. The full InChI is InChI=1S/C17H30N2O3Si/c1-7-11-21-16(20)19-13-15(12-14(19)9-8-10-18)22-23(5,6)17(2,3)4/h7,14-15H,1,8-9,11-13H2,2-6H3/t14-,15-/m1/s1.
What are the key properties of prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyanoethyl)pyrrolidine-1-carboxylate?
prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyanoethyl)pyrrolidine-1-carboxylate has a molecular weight of 338.52 g/mol, XLogP of 4.08, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyanoethyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 139660628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).