About 4-bromo-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene
4-bromo-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene (PubChem CID 139660789) has the molecular formula C22H28BrF5O
and a molecular weight of 483.36 g/mol. Its IUPAC name is 4-bromo-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene.
Molecular Properties
| Compound Name | 4-bromo-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene |
| PubChem CID | 139660789 |
| Molecular Formula | C22H28BrF5O |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 4-bromo-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene |
| SMILES | CCCC1CCC(C2CCC(c3cc(F)c(OC(F)(F)F)c(F)c3Br)CC2)CC1 |
| InChI | InChI=1S/C22H28BrF5O/c1-2-3-13-4-6-14(7-5-13)15-8-10-16(11-9-15)17-12-18(24)21(20(25)19(17)23)29-22(26,27)28/h12-16H,2-11H2,1H3 |
| InChIKey | BYGNLCMMDREOBB-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene?
The IUPAC name of 4-bromo-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene (CID 139660789) is 4-bromo-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene.
What is the SMILES notation for 4-bromo-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene?
The canonical SMILES for 4-bromo-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene is CCCC1CCC(C2CCC(c3cc(F)c(OC(F)(F)F)c(F)c3Br)CC2)CC1.
What is the InChIKey of 4-bromo-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene?
The InChIKey is BYGNLCMMDREOBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28BrF5O/c1-2-3-13-4-6-14(7-5-13)15-8-10-16(11-9-15)17-12-18(24)21(20(25)19(17)23)29-22(26,27)28/h12-16H,2-11H2,1H3.
What are the key properties of 4-bromo-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene?
4-bromo-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene has a molecular weight of 483.36 g/mol, XLogP of 8.51, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,3-difluoro-5-[4-(4-propylcyclohexyl)cyclohexyl]-2-(trifluoromethoxy)benzene is sourced from PubChem (CID 139660789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).