About 3-phenyl-3-propan-2-yl-2,4-dihydropyrrol-5-amine
3-phenyl-3-propan-2-yl-2,4-dihydropyrrol-5-amine (PubChem CID 139660847) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-phenyl-3-propan-2-yl-2,4-dihydropyrrol-5-amine.
Molecular Properties
| Compound Name | 3-phenyl-3-propan-2-yl-2,4-dihydropyrrol-5-amine |
| PubChem CID | 139660847 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 3-phenyl-3-propan-2-yl-2,4-dihydropyrrol-5-amine |
| SMILES | CC(C)C1(c2ccccc2)CN=C(N)C1 |
| InChI | InChI=1S/C13H18N2/c1-10(2)13(8-12(14)15-9-13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H2,14,15) |
| InChIKey | CTCCUNZJJLWINS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-3-propan-2-yl-2,4-dihydropyrrol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-3-propan-2-yl-2,4-dihydropyrrol-5-amine?
The IUPAC name of 3-phenyl-3-propan-2-yl-2,4-dihydropyrrol-5-amine (CID 139660847) is 3-phenyl-3-propan-2-yl-2,4-dihydropyrrol-5-amine.
What is the SMILES notation for 3-phenyl-3-propan-2-yl-2,4-dihydropyrrol-5-amine?
The canonical SMILES for 3-phenyl-3-propan-2-yl-2,4-dihydropyrrol-5-amine is CC(C)C1(c2ccccc2)CN=C(N)C1.
What is the InChIKey of 3-phenyl-3-propan-2-yl-2,4-dihydropyrrol-5-amine?
The InChIKey is CTCCUNZJJLWINS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c1-10(2)13(8-12(14)15-9-13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3,(H2,14,15).
What are the key properties of 3-phenyl-3-propan-2-yl-2,4-dihydropyrrol-5-amine?
3-phenyl-3-propan-2-yl-2,4-dihydropyrrol-5-amine has a molecular weight of 202.30 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-3-propan-2-yl-2,4-dihydropyrrol-5-amine is sourced from PubChem (CID 139660847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).