About 2-[3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(trifluoromethyl)phenyl]phthalazin-1-one
2-[3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(trifluoromethyl)phenyl]phthalazin-1-one (PubChem CID 139660885) has the molecular formula C22H11F5N2O3
and a molecular weight of 446.33 g/mol. Its IUPAC name is 2-[3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(trifluoromethyl)phenyl]phthalazin-1-one.
Molecular Properties
| Compound Name | 2-[3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(trifluoromethyl)phenyl]phthalazin-1-one |
| PubChem CID | 139660885 |
| Molecular Formula | C22H11F5N2O3 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 2-[3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(trifluoromethyl)phenyl]phthalazin-1-one |
| SMILES | O=c1c2ccccc2cnn1-c1ccc(C(F)(F)F)c(-c2cccc3c2OC(F)(F)O3)c1 |
| InChI | InChI=1S/C22H11F5N2O3/c23-21(24,25)17-9-8-13(29-20(30)14-5-2-1-4-12(14)11-28-29)10-16(17)15-6-3-7-18-19(15)32-22(26,27)31-18/h1-11H |
| InChIKey | MDEUFBZUKOVUSQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(trifluoromethyl)phenyl]phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(trifluoromethyl)phenyl]phthalazin-1-one?
The IUPAC name of 2-[3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(trifluoromethyl)phenyl]phthalazin-1-one (CID 139660885) is 2-[3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(trifluoromethyl)phenyl]phthalazin-1-one.
What is the SMILES notation for 2-[3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(trifluoromethyl)phenyl]phthalazin-1-one?
The canonical SMILES for 2-[3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(trifluoromethyl)phenyl]phthalazin-1-one is O=c1c2ccccc2cnn1-c1ccc(C(F)(F)F)c(-c2cccc3c2OC(F)(F)O3)c1.
What is the InChIKey of 2-[3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(trifluoromethyl)phenyl]phthalazin-1-one?
The InChIKey is MDEUFBZUKOVUSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H11F5N2O3/c23-21(24,25)17-9-8-13(29-20(30)14-5-2-1-4-12(14)11-28-29)10-16(17)15-6-3-7-18-19(15)32-22(26,27)31-18/h1-11H.
What are the key properties of 2-[3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(trifluoromethyl)phenyl]phthalazin-1-one?
2-[3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(trifluoromethyl)phenyl]phthalazin-1-one has a molecular weight of 446.33 g/mol, XLogP of 5.39, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,2-difluoro-1,3-benzodioxol-4-yl)-4-(trifluoromethyl)phenyl]phthalazin-1-one is sourced from PubChem (CID 139660885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).