C15H29NO4 — CID 139661267
ethyl 2-(hydroxycarbamoyl)-5-methyl-2-(3-methylbutyl)hexanoate (PubChem CID 139661267) has the molecular formula C15H29NO4 and a molecular weight of 287.40 g/mol. Its IUPAC name is ethyl 2-(hydroxycarbamoyl)-5-methyl-2-(3-methylbutyl)hexanoate.
| Compound Name | ethyl 2-(hydroxycarbamoyl)-5-methyl-2-(3-methylbutyl)hexanoate |
|---|---|
| PubChem CID | 139661267 |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | ethyl 2-(hydroxycarbamoyl)-5-methyl-2-(3-methylbutyl)hexanoate |
| SMILES | CCOC(=O)C(CCC(C)C)(CCC(C)C)C(=O)NO |
| InChI | InChI=1S/C15H29NO4/c1-6-20-14(18)15(13(17)16-19,9-7-11(2)3)10-8-12(4)5/h11-12,19H,6-10H2,1-5H3,(H,16,17) |
| InChIKey | VPRITYRYAUHACB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|