C32H26Cl2N2O3 — CID 139661330
ethyl 8-[bis(4-chlorophenyl)-hydroxymethyl]-4-(2-methylanilino)quinoline-3-carboxylate (PubChem CID 139661330) has the molecular formula C32H26Cl2N2O3 and a molecular weight of 557.48 g/mol. Its IUPAC name is ethyl 8-[bis(4-chlorophenyl)-hydroxymethyl]-4-(2-methylanilino)quinoline-3-carboxylate.
| Compound Name | ethyl 8-[bis(4-chlorophenyl)-hydroxymethyl]-4-(2-methylanilino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 139661330 |
| Molecular Formula | C32H26Cl2N2O3 |
| Molecular Weight | 557.48 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | ethyl 8-[bis(4-chlorophenyl)-hydroxymethyl]-4-(2-methylanilino)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(C(O)(c3ccc(Cl)cc3)c3ccc(Cl)cc3)cccc2c1Nc1ccccc1C |
| InChI | InChI=1S/C32H26Cl2N2O3/c1-3-39-31(37)26-19-35-30-25(29(26)36-28-10-5-4-7-20(28)2)8-6-9-27(30)32(38,21-11-15-23(33)16-12-21)22-13-17-24(34)18-14-22/h4-19,38H,3H2,1-2H3,(H,35,36) |
| InChIKey | NLWPXOMEYMFVPA-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.48 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|