C25H43N — CID 139662729
1-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperidine (PubChem CID 139662729) has the molecular formula C25H43N and a molecular weight of 357.63 g/mol. Its IUPAC name is 1-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperidine.
| Compound Name | 1-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperidine |
|---|---|
| PubChem CID | 139662729 |
| Molecular Formula | C25H43N |
| Molecular Weight | 357.63 g/mol |
| Exact Mass | 357.34 |
| IUPAC Name | 1-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperidine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CN1CCCCC1 |
| InChI | InChI=1S/C25H43N/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)18-21-26-19-7-6-8-20-26/h12,14,16,18H,6-11,13,15,17,19-21H2,1-5H3/b23-14+,24-16+,25-18+ |
| InChIKey | PRUFVHGFSDFZQF-WCGUESEVSA-N |
| XLogP | 7.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.63 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|