C12H18O5 — CID 139663576
2,2,2',2'-tetramethyl-6'-methylidenespiro[1,3-dioxolane-4,4'-3a,6a-dihydrofuro[3,4-d][1,3]dioxole] (PubChem CID 139663576) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 2,2,2',2'-tetramethyl-6'-methylidenespiro[1,3-dioxolane-4,4'-3a,6a-dihydrofuro[3,4-d][1,3]dioxole].
| Compound Name | 2,2,2',2'-tetramethyl-6'-methylidenespiro[1,3-dioxolane-4,4'-3a,6a-dihydrofuro[3,4-d][1,3]dioxole] |
|---|---|
| PubChem CID | 139663576 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2,2,2',2'-tetramethyl-6'-methylidenespiro[1,3-dioxolane-4,4'-3a,6a-dihydrofuro[3,4-d][1,3]dioxole] |
| SMILES | C=C1OC2(COC(C)(C)O2)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C12H18O5/c1-7-8-9(16-11(4,5)15-8)12(14-7)6-13-10(2,3)17-12/h8-9H,1,6H2,2-5H3 |
| InChIKey | PQUCVHYLKNUCPF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |